C12H20ClIN2O2S — CID 119993373
N-(1-aminohexan-2-yl)-3-iodobenzenesulfonamide;hydrochloride (PubChem CID 119993373) has the molecular formula C12H20ClIN2O2S and a molecular weight of 418.73 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-3-iodobenzenesulfonamide;hydrochloride.
| Compound Name | N-(1-aminohexan-2-yl)-3-iodobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119993373 |
| Molecular Formula | C12H20ClIN2O2S |
| Molecular Weight | 418.73 g/mol |
| Exact Mass | 418.00 |
| IUPAC Name | N-(1-aminohexan-2-yl)-3-iodobenzenesulfonamide;hydrochloride |
| SMILES | CCCCC(CN)NS(=O)(=O)c1cccc(I)c1.Cl |
| InChI | InChI=1S/C12H19IN2O2S.ClH/c1-2-3-6-11(9-14)15-18(16,17)12-7-4-5-10(13)8-12;/h4-5,7-8,11,15H,2-3,6,9,14H2,1H3;1H |
| InChIKey | AYMVLEMBKYBCLT-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.73 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|