C11H19N3O4S2 — CID 65193230
3-N-(1-aminopentan-2-yl)benzene-1,3-disulfonamide (PubChem CID 65193230) has the molecular formula C11H19N3O4S2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 3-N-(1-aminopentan-2-yl)benzene-1,3-disulfonamide.
| Compound Name | 3-N-(1-aminopentan-2-yl)benzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 65193230 |
| Molecular Formula | C11H19N3O4S2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 3-N-(1-aminopentan-2-yl)benzene-1,3-disulfonamide |
| SMILES | CCCC(CN)NS(=O)(=O)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C11H19N3O4S2/c1-2-4-9(8-12)14-20(17,18)11-6-3-5-10(7-11)19(13,15)16/h3,5-7,9,14H,2,4,8,12H2,1H3,(H2,13,15,16) |
| InChIKey | APIWRCAKPJGZDU-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 132.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |