C11H16N2O4S2 — CID 115632091
3-N-pent-4-en-2-ylbenzene-1,3-disulfonamide (PubChem CID 115632091) has the molecular formula C11H16N2O4S2 and a molecular weight of 304.39 g/mol. Its IUPAC name is 3-N-pent-4-en-2-ylbenzene-1,3-disulfonamide.
| Compound Name | 3-N-pent-4-en-2-ylbenzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 115632091 |
| Molecular Formula | C11H16N2O4S2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 3-N-pent-4-en-2-ylbenzene-1,3-disulfonamide |
| SMILES | C=CCC(C)NS(=O)(=O)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C11H16N2O4S2/c1-3-5-9(2)13-19(16,17)11-7-4-6-10(8-11)18(12,14)15/h3-4,6-9,13H,1,5H2,2H3,(H2,12,14,15) |
| InChIKey | MLGAFMBEBSDMRL-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|