C16H30ClN3O4S2 — CID 119993076
N-(1-aminohexan-2-yl)-4-(butylsulfonylamino)benzenesulfonamide;hydrochloride (PubChem CID 119993076) has the molecular formula C16H30ClN3O4S2 and a molecular weight of 428.02 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-4-(butylsulfonylamino)benzenesulfonamide;hydrochloride.
| Compound Name | N-(1-aminohexan-2-yl)-4-(butylsulfonylamino)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119993076 |
| Molecular Formula | C16H30ClN3O4S2 |
| Molecular Weight | 428.02 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | N-(1-aminohexan-2-yl)-4-(butylsulfonylamino)benzenesulfonamide;hydrochloride |
| SMILES | CCCCC(CN)NS(=O)(=O)c1ccc(NS(=O)(=O)CCCC)cc1.Cl |
| InChI | InChI=1S/C16H29N3O4S2.ClH/c1-3-5-7-15(13-17)19-25(22,23)16-10-8-14(9-11-16)18-24(20,21)12-6-4-2;/h8-11,15,18-19H,3-7,12-13,17H2,1-2H3;1H |
| InChIKey | YHQFSABHOBBRKC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.02 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |