C12H18Cl2N2O4S — CID 119043378
methyl 2-chloro-4-[3-(methylamino)propylsulfamoyl]benzoate;hydrochloride (PubChem CID 119043378) has the molecular formula C12H18Cl2N2O4S and a molecular weight of 357.26 g/mol. Its IUPAC name is methyl 2-chloro-4-[3-(methylamino)propylsulfamoyl]benzoate;hydrochloride.
| Compound Name | methyl 2-chloro-4-[3-(methylamino)propylsulfamoyl]benzoate;hydrochloride |
|---|---|
| PubChem CID | 119043378 |
| Molecular Formula | C12H18Cl2N2O4S |
| Molecular Weight | 357.26 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | methyl 2-chloro-4-[3-(methylamino)propylsulfamoyl]benzoate;hydrochloride |
| SMILES | CNCCCNS(=O)(=O)c1ccc(C(=O)OC)c(Cl)c1.Cl |
| InChI | InChI=1S/C12H17ClN2O4S.ClH/c1-14-6-3-7-15-20(17,18)9-4-5-10(11(13)8-9)12(16)19-2;/h4-5,8,14-15H,3,6-7H2,1-2H3;1H |
| InChIKey | DVJAVCGUCWOHGN-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.26 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|