C16H17ClN2O4S — CID 124687144
methyl 4-[[(2R)-2-amino-2-phenylethyl]sulfamoyl]-2-chlorobenzoate (PubChem CID 124687144) has the molecular formula C16H17ClN2O4S and a molecular weight of 368.84 g/mol. Its IUPAC name is methyl 4-[[(2R)-2-amino-2-phenylethyl]sulfamoyl]-2-chlorobenzoate.
| Compound Name | methyl 4-[[(2R)-2-amino-2-phenylethyl]sulfamoyl]-2-chlorobenzoate |
|---|---|
| PubChem CID | 124687144 |
| Molecular Formula | C16H17ClN2O4S |
| Molecular Weight | 368.84 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | methyl 4-[[(2R)-2-amino-2-phenylethyl]sulfamoyl]-2-chlorobenzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)NC[C@H](N)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C16H17ClN2O4S/c1-23-16(20)13-8-7-12(9-14(13)17)24(21,22)19-10-15(18)11-5-3-2-4-6-11/h2-9,15,19H,10,18H2,1H3/t15-/m0/s1 |
| InChIKey | BUYNDTQKHBGHNT-HNNXBMFYSA-N |
| XLogP | 2.10 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.84 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |