C15H21ClN2O4S — CID 119043375
methyl 4-[(1-aminocyclohexyl)methylsulfamoyl]-2-chlorobenzoate (PubChem CID 119043375) has the molecular formula C15H21ClN2O4S and a molecular weight of 360.86 g/mol. Its IUPAC name is methyl 4-[(1-aminocyclohexyl)methylsulfamoyl]-2-chlorobenzoate.
| Compound Name | methyl 4-[(1-aminocyclohexyl)methylsulfamoyl]-2-chlorobenzoate |
|---|---|
| PubChem CID | 119043375 |
| Molecular Formula | C15H21ClN2O4S |
| Molecular Weight | 360.86 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | methyl 4-[(1-aminocyclohexyl)methylsulfamoyl]-2-chlorobenzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)NCC2(N)CCCCC2)cc1Cl |
| InChI | InChI=1S/C15H21ClN2O4S/c1-22-14(19)12-6-5-11(9-13(12)16)23(20,21)18-10-15(17)7-3-2-4-8-15/h5-6,9,18H,2-4,7-8,10,17H2,1H3 |
| InChIKey | KGBBZSCQQIPIJN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.86 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |