C16H27N3O4S2 — CID 120875665
4-N-[(1-aminocycloheptyl)methyl]-1-N,2-dimethylbenzene-1,4-disulfonamide (PubChem CID 120875665) has the molecular formula C16H27N3O4S2 and a molecular weight of 389.54 g/mol. Its IUPAC name is 4-N-[(1-aminocycloheptyl)methyl]-1-N,2-dimethylbenzene-1,4-disulfonamide.
| Compound Name | 4-N-[(1-aminocycloheptyl)methyl]-1-N,2-dimethylbenzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 120875665 |
| Molecular Formula | C16H27N3O4S2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 4-N-[(1-aminocycloheptyl)methyl]-1-N,2-dimethylbenzene-1,4-disulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(S(=O)(=O)NCC2(N)CCCCCC2)cc1C |
| InChI | InChI=1S/C16H27N3O4S2/c1-13-11-14(7-8-15(13)25(22,23)18-2)24(20,21)19-12-16(17)9-5-3-4-6-10-16/h7-8,11,18-19H,3-6,9-10,12,17H2,1-2H3 |
| InChIKey | HDQWKQAEQPBPGG-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |