C15H25ClN2O2S — CID 119998536
N-[(1-aminocycloheptyl)methyl]-2-methylbenzenesulfonamide;hydrochloride (PubChem CID 119998536) has the molecular formula C15H25ClN2O2S and a molecular weight of 332.90 g/mol. Its IUPAC name is N-[(1-aminocycloheptyl)methyl]-2-methylbenzenesulfonamide;hydrochloride.
| Compound Name | N-[(1-aminocycloheptyl)methyl]-2-methylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119998536 |
| Molecular Formula | C15H25ClN2O2S |
| Molecular Weight | 332.90 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | N-[(1-aminocycloheptyl)methyl]-2-methylbenzenesulfonamide;hydrochloride |
| SMILES | Cc1ccccc1S(=O)(=O)NCC1(N)CCCCCC1.Cl |
| InChI | InChI=1S/C15H24N2O2S.ClH/c1-13-8-4-5-9-14(13)20(18,19)17-12-15(16)10-6-2-3-7-11-15;/h4-5,8-9,17H,2-3,6-7,10-12,16H2,1H3;1H |
| InChIKey | NLCMABASCSHSSZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.90 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |