C15H24ClFN2O2S — CID 119998528
N-[(1-aminocycloheptyl)methyl]-2-fluoro-5-methylbenzenesulfonamide;hydrochloride (PubChem CID 119998528) has the molecular formula C15H24ClFN2O2S and a molecular weight of 350.89 g/mol. Its IUPAC name is N-[(1-aminocycloheptyl)methyl]-2-fluoro-5-methylbenzenesulfonamide;hydrochloride.
| Compound Name | N-[(1-aminocycloheptyl)methyl]-2-fluoro-5-methylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119998528 |
| Molecular Formula | C15H24ClFN2O2S |
| Molecular Weight | 350.89 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | N-[(1-aminocycloheptyl)methyl]-2-fluoro-5-methylbenzenesulfonamide;hydrochloride |
| SMILES | Cc1ccc(F)c(S(=O)(=O)NCC2(N)CCCCCC2)c1.Cl |
| InChI | InChI=1S/C15H23FN2O2S.ClH/c1-12-6-7-13(16)14(10-12)21(19,20)18-11-15(17)8-4-2-3-5-9-15;/h6-7,10,18H,2-5,8-9,11,17H2,1H3;1H |
| InChIKey | ZTPKPZSJIBFWGM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.89 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |