C15H21ClN2O4S — CID 124687158
methyl 4-[[(1R,2S)-2-(aminomethyl)cyclohexyl]sulfamoyl]-2-chlorobenzoate (PubChem CID 124687158) has the molecular formula C15H21ClN2O4S and a molecular weight of 360.86 g/mol. Its IUPAC name is methyl 4-[[(1R,2S)-2-(aminomethyl)cyclohexyl]sulfamoyl]-2-chlorobenzoate.
| Compound Name | methyl 4-[[(1R,2S)-2-(aminomethyl)cyclohexyl]sulfamoyl]-2-chlorobenzoate |
|---|---|
| PubChem CID | 124687158 |
| Molecular Formula | C15H21ClN2O4S |
| Molecular Weight | 360.86 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | methyl 4-[[(1R,2S)-2-(aminomethyl)cyclohexyl]sulfamoyl]-2-chlorobenzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)N[C@@H]2CCCC[C@H]2CN)cc1Cl |
| InChI | InChI=1S/C15H21ClN2O4S/c1-22-15(19)12-7-6-11(8-13(12)16)23(20,21)18-14-5-3-2-4-10(14)9-17/h6-8,10,14,18H,2-5,9,17H2,1H3/t10-,14+/m0/s1 |
| InChIKey | OIYKOVVFMSUXIJ-IINYFYTJSA-N |
| XLogP | 1.92 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.86 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |