C15H24N2O4S2 — CID 119986184
N-[2-(aminomethyl)cyclohexyl]-3-ethylsulfonylbenzenesulfonamide (PubChem CID 119986184) has the molecular formula C15H24N2O4S2 and a molecular weight of 360.50 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclohexyl]-3-ethylsulfonylbenzenesulfonamide.
| Compound Name | N-[2-(aminomethyl)cyclohexyl]-3-ethylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 119986184 |
| Molecular Formula | C15H24N2O4S2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | N-[2-(aminomethyl)cyclohexyl]-3-ethylsulfonylbenzenesulfonamide |
| SMILES | CCS(=O)(=O)c1cccc(S(=O)(=O)NC2CCCCC2CN)c1 |
| InChI | InChI=1S/C15H24N2O4S2/c1-2-22(18,19)13-7-5-8-14(10-13)23(20,21)17-15-9-4-3-6-12(15)11-16/h5,7-8,10,12,15,17H,2-4,6,9,11,16H2,1H3 |
| InChIKey | SRRMACFZIWQKIZ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |