C16H25NO4S2 — CID 60530988
N-(2-ethylcyclohexyl)-4-ethylsulfonylbenzenesulfonamide (PubChem CID 60530988) has the molecular formula C16H25NO4S2 and a molecular weight of 359.51 g/mol. Its IUPAC name is N-(2-ethylcyclohexyl)-4-ethylsulfonylbenzenesulfonamide.
| Compound Name | N-(2-ethylcyclohexyl)-4-ethylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 60530988 |
| Molecular Formula | C16H25NO4S2 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | N-(2-ethylcyclohexyl)-4-ethylsulfonylbenzenesulfonamide |
| SMILES | CCC1CCCCC1NS(=O)(=O)c1ccc(S(=O)(=O)CC)cc1 |
| InChI | InChI=1S/C16H25NO4S2/c1-3-13-7-5-6-8-16(13)17-23(20,21)15-11-9-14(10-12-15)22(18,19)4-2/h9-13,16-17H,3-8H2,1-2H3 |
| InChIKey | JAPDPTCSZJTAAA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |