C13H18ClNO2S — CID 114179811
N-[2-(chloromethyl)cyclohexyl]benzenesulfonamide (PubChem CID 114179811) has the molecular formula C13H18ClNO2S and a molecular weight of 287.81 g/mol. Its IUPAC name is N-[2-(chloromethyl)cyclohexyl]benzenesulfonamide.
| Compound Name | N-[2-(chloromethyl)cyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 114179811 |
| Molecular Formula | C13H18ClNO2S |
| Molecular Weight | 287.81 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | N-[2-(chloromethyl)cyclohexyl]benzenesulfonamide |
| SMILES | O=S(=O)(NC1CCCCC1CCl)c1ccccc1 |
| InChI | InChI=1S/C13H18ClNO2S/c14-10-11-6-4-5-9-13(11)15-18(16,17)12-7-2-1-3-8-12/h1-3,7-8,11,13,15H,4-6,9-10H2 |
| InChIKey | QNMGAKOOINHIDK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.81 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|