C20H22ClNO4S — CID 161417428
2-[2-[[2-[(4-chlorophenyl)sulfonylamino]cyclopentyl]methyl]phenyl]acetic acid (PubChem CID 161417428) has the molecular formula C20H22ClNO4S and a molecular weight of 407.92 g/mol. Its IUPAC name is 2-[2-[[2-[(4-chlorophenyl)sulfonylamino]cyclopentyl]methyl]phenyl]acetic acid.
| Compound Name | 2-[2-[[2-[(4-chlorophenyl)sulfonylamino]cyclopentyl]methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 161417428 |
| Molecular Formula | C20H22ClNO4S |
| Molecular Weight | 407.92 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | 2-[2-[[2-[(4-chlorophenyl)sulfonylamino]cyclopentyl]methyl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccccc1CC1CCCC1NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H22ClNO4S/c21-17-8-10-18(11-9-17)27(25,26)22-19-7-3-6-16(19)12-14-4-1-2-5-15(14)13-20(23)24/h1-2,4-5,8-11,16,19,22H,3,6-7,12-13H2,(H,23,24) |
| InChIKey | VWGPPVAZFUDRQI-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.92 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |