C18H20ClNO2S2 — CID 2975041
4-chloro-N-(2-phenylsulfanylcyclohexyl)benzenesulfonamide (PubChem CID 2975041) has the molecular formula C18H20ClNO2S2 and a molecular weight of 381.95 g/mol. Its IUPAC name is 4-chloro-N-(2-phenylsulfanylcyclohexyl)benzenesulfonamide.
| Compound Name | 4-chloro-N-(2-phenylsulfanylcyclohexyl)benzenesulfonamide |
|---|---|
| PubChem CID | 2975041 |
| Molecular Formula | C18H20ClNO2S2 |
| Molecular Weight | 381.95 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | 4-chloro-N-(2-phenylsulfanylcyclohexyl)benzenesulfonamide |
| SMILES | O=S(=O)(NC1CCCCC1Sc1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H20ClNO2S2/c19-14-10-12-16(13-11-14)24(21,22)20-17-8-4-5-9-18(17)23-15-6-2-1-3-7-15/h1-3,6-7,10-13,17-18,20H,4-5,8-9H2 |
| InChIKey | ZCZSDKGNECAPBF-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.95 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |