C18H19ClFNO2S2 — CID 2198514
4-chloro-N-[(1R,2R)-2-(4-fluorophenyl)sulfanylcyclohexyl]benzenesulfonamide (PubChem CID 2198514) has the molecular formula C18H19ClFNO2S2 and a molecular weight of 399.94 g/mol. Its IUPAC name is 4-chloro-N-[(1R,2R)-2-(4-fluorophenyl)sulfanylcyclohexyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[(1R,2R)-2-(4-fluorophenyl)sulfanylcyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 2198514 |
| Molecular Formula | C18H19ClFNO2S2 |
| Molecular Weight | 399.94 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | 4-chloro-N-[(1R,2R)-2-(4-fluorophenyl)sulfanylcyclohexyl]benzenesulfonamide |
| SMILES | O=S(=O)(N[C@@H]1CCCC[C@H]1Sc1ccc(F)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H19ClFNO2S2/c19-13-5-11-16(12-6-13)25(22,23)21-17-3-1-2-4-18(17)24-15-9-7-14(20)8-10-15/h5-12,17-18,21H,1-4H2/t17-,18-/m1/s1 |
| InChIKey | FVXSYGFMACEWJH-QZTJIDSGSA-N |
| XLogP | 4.86 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.94 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |