C18H20F2N2O4S2 — CID 2975212
4-fluoro-N-[2-[(4-fluorophenyl)sulfonylamino]cyclohexyl]benzenesulfonamide (PubChem CID 2975212) has the molecular formula C18H20F2N2O4S2 and a molecular weight of 430.50 g/mol. Its IUPAC name is 4-fluoro-N-[2-[(4-fluorophenyl)sulfonylamino]cyclohexyl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[2-[(4-fluorophenyl)sulfonylamino]cyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 2975212 |
| Molecular Formula | C18H20F2N2O4S2 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | 4-fluoro-N-[2-[(4-fluorophenyl)sulfonylamino]cyclohexyl]benzenesulfonamide |
| SMILES | O=S(=O)(NC1CCCCC1NS(=O)(=O)c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H20F2N2O4S2/c19-13-5-9-15(10-6-13)27(23,24)21-17-3-1-2-4-18(17)22-28(25,26)16-11-7-14(20)8-12-16/h5-12,17-18,21-22H,1-4H2 |
| InChIKey | HCBUFVLQTOCRFR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |