C11H15FN2O2S — CID 104826095
4-fluoro-N-(4-methylpyrrolidin-3-yl)benzenesulfonamide (PubChem CID 104826095) has the molecular formula C11H15FN2O2S and a molecular weight of 258.32 g/mol. Its IUPAC name is 4-fluoro-N-(4-methylpyrrolidin-3-yl)benzenesulfonamide.
| Compound Name | 4-fluoro-N-(4-methylpyrrolidin-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 104826095 |
| Molecular Formula | C11H15FN2O2S |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 4-fluoro-N-(4-methylpyrrolidin-3-yl)benzenesulfonamide |
| SMILES | CC1CNCC1NS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H15FN2O2S/c1-8-6-13-7-11(8)14-17(15,16)10-4-2-9(12)3-5-10/h2-5,8,11,13-14H,6-7H2,1H3 |
| InChIKey | YXVYWAOJRRJCPR-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |