C16H27ClN2O2S — CID 120725276
4-tert-butyl-N-(3-methylpiperidin-4-yl)benzenesulfonamide;hydrochloride (PubChem CID 120725276) has the molecular formula C16H27ClN2O2S and a molecular weight of 346.92 g/mol. Its IUPAC name is 4-tert-butyl-N-(3-methylpiperidin-4-yl)benzenesulfonamide;hydrochloride.
| Compound Name | 4-tert-butyl-N-(3-methylpiperidin-4-yl)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120725276 |
| Molecular Formula | C16H27ClN2O2S |
| Molecular Weight | 346.92 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 4-tert-butyl-N-(3-methylpiperidin-4-yl)benzenesulfonamide;hydrochloride |
| SMILES | CC1CNCCC1NS(=O)(=O)c1ccc(C(C)(C)C)cc1.Cl |
| InChI | InChI=1S/C16H26N2O2S.ClH/c1-12-11-17-10-9-15(12)18-21(19,20)14-7-5-13(6-8-14)16(2,3)4;/h5-8,12,15,17-18H,9-11H2,1-4H3;1H |
| InChIKey | MWVOQIOWBGIFDX-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.92 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |