C12H16ClF3N2O2S — CID 120725034
2,3,4-trifluoro-N-(3-methylpiperidin-4-yl)benzenesulfonamide;hydrochloride (PubChem CID 120725034) has the molecular formula C12H16ClF3N2O2S and a molecular weight of 344.79 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-(3-methylpiperidin-4-yl)benzenesulfonamide;hydrochloride.
| Compound Name | 2,3,4-trifluoro-N-(3-methylpiperidin-4-yl)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120725034 |
| Molecular Formula | C12H16ClF3N2O2S |
| Molecular Weight | 344.79 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 2,3,4-trifluoro-N-(3-methylpiperidin-4-yl)benzenesulfonamide;hydrochloride |
| SMILES | CC1CNCCC1NS(=O)(=O)c1ccc(F)c(F)c1F.Cl |
| InChI | InChI=1S/C12H15F3N2O2S.ClH/c1-7-6-16-5-4-9(7)17-20(18,19)10-3-2-8(13)11(14)12(10)15;/h2-3,7,9,16-17H,4-6H2,1H3;1H |
| InChIKey | GZYPCWPPHYXTBM-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.79 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|