C10H11F3N2O2S — CID 55068837
2,3,4-trifluoro-N-pyrrolidin-3-ylbenzenesulfonamide (PubChem CID 55068837) has the molecular formula C10H11F3N2O2S and a molecular weight of 280.27 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-pyrrolidin-3-ylbenzenesulfonamide.
| Compound Name | 2,3,4-trifluoro-N-pyrrolidin-3-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 55068837 |
| Molecular Formula | C10H11F3N2O2S |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 2,3,4-trifluoro-N-pyrrolidin-3-ylbenzenesulfonamide |
| SMILES | O=S(=O)(NC1CCNC1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C10H11F3N2O2S/c11-7-1-2-8(10(13)9(7)12)18(16,17)15-6-3-4-14-5-6/h1-2,6,14-15H,3-5H2 |
| InChIKey | JHZYGHHMIXVOGZ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|