C19H22FN3O3S — CID 120724923
4-fluoro-N-[4-[(3-methylpiperidin-4-yl)sulfamoyl]phenyl]benzamide (PubChem CID 120724923) has the molecular formula C19H22FN3O3S and a molecular weight of 391.47 g/mol. Its IUPAC name is 4-fluoro-N-[4-[(3-methylpiperidin-4-yl)sulfamoyl]phenyl]benzamide.
| Compound Name | 4-fluoro-N-[4-[(3-methylpiperidin-4-yl)sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 120724923 |
| Molecular Formula | C19H22FN3O3S |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 4-fluoro-N-[4-[(3-methylpiperidin-4-yl)sulfamoyl]phenyl]benzamide |
| SMILES | CC1CNCCC1NS(=O)(=O)c1ccc(NC(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H22FN3O3S/c1-13-12-21-11-10-18(13)23-27(25,26)17-8-6-16(7-9-17)22-19(24)14-2-4-15(20)5-3-14/h2-9,13,18,21,23H,10-12H2,1H3,(H,22,24) |
| InChIKey | VZBMTTVURVWUJT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |