C19H23ClFN3O3S — CID 119985454
N-[4-[[2-(aminomethyl)cyclopentyl]sulfamoyl]phenyl]-4-fluorobenzamide;hydrochloride (PubChem CID 119985454) has the molecular formula C19H23ClFN3O3S and a molecular weight of 427.93 g/mol. Its IUPAC name is N-[4-[[2-(aminomethyl)cyclopentyl]sulfamoyl]phenyl]-4-fluorobenzamide;hydrochloride.
| Compound Name | N-[4-[[2-(aminomethyl)cyclopentyl]sulfamoyl]phenyl]-4-fluorobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119985454 |
| Molecular Formula | C19H23ClFN3O3S |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | N-[4-[[2-(aminomethyl)cyclopentyl]sulfamoyl]phenyl]-4-fluorobenzamide;hydrochloride |
| SMILES | Cl.NCC1CCCC1NS(=O)(=O)c1ccc(NC(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H22FN3O3S.ClH/c20-15-6-4-13(5-7-15)19(24)22-16-8-10-17(11-9-16)27(25,26)23-18-3-1-2-14(18)12-21;/h4-11,14,18,23H,1-3,12,21H2,(H,22,24);1H |
| InChIKey | LPWQMHFPGFTUSU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |