C11H14FNO3S — CID 40650403
4-fluoro-N-[(1S,2S)-2-hydroxycyclopentyl]benzenesulfonamide (PubChem CID 40650403) has the molecular formula C11H14FNO3S and a molecular weight of 259.30 g/mol. Its IUPAC name is 4-fluoro-N-[(1S,2S)-2-hydroxycyclopentyl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[(1S,2S)-2-hydroxycyclopentyl]benzenesulfonamide |
|---|---|
| PubChem CID | 40650403 |
| Molecular Formula | C11H14FNO3S |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 4-fluoro-N-[(1S,2S)-2-hydroxycyclopentyl]benzenesulfonamide |
| SMILES | O=S(=O)(N[C@H]1CCC[C@@H]1O)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H14FNO3S/c12-8-4-6-9(7-5-8)17(15,16)13-10-2-1-3-11(10)14/h4-7,10-11,13-14H,1-3H2/t10-,11-/m0/s1 |
| InChIKey | VBOKHTVENLKZOT-QWRGUYRKSA-N |
| XLogP | 1.02 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |