C12H17FN2O3S — CID 107213611
4-amino-3-fluoro-N-[(1R,2R)-2-hydroxycyclohexyl]benzenesulfonamide (PubChem CID 107213611) has the molecular formula C12H17FN2O3S and a molecular weight of 288.34 g/mol. Its IUPAC name is 4-amino-3-fluoro-N-[(1R,2R)-2-hydroxycyclohexyl]benzenesulfonamide.
| Compound Name | 4-amino-3-fluoro-N-[(1R,2R)-2-hydroxycyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 107213611 |
| Molecular Formula | C12H17FN2O3S |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 4-amino-3-fluoro-N-[(1R,2R)-2-hydroxycyclohexyl]benzenesulfonamide |
| SMILES | Nc1ccc(S(=O)(=O)N[C@@H]2CCCC[C@H]2O)cc1F |
| InChI | InChI=1S/C12H17FN2O3S/c13-9-7-8(5-6-10(9)14)19(17,18)15-11-3-1-2-4-12(11)16/h5-7,11-12,15-16H,1-4,14H2/t11-,12-/m1/s1 |
| InChIKey | KKFWPUHOAPEXLO-VXGBXAGGSA-N |
| XLogP | 0.99 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|