C14H20FN3O2S — CID 82845893
4-amino-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-3-fluorobenzenesulfonamide (PubChem CID 82845893) has the molecular formula C14H20FN3O2S and a molecular weight of 313.40 g/mol. Its IUPAC name is 4-amino-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-3-fluorobenzenesulfonamide.
| Compound Name | 4-amino-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 82845893 |
| Molecular Formula | C14H20FN3O2S |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 4-amino-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-3-fluorobenzenesulfonamide |
| SMILES | Nc1ccc(S(=O)(=O)NC2CCN3CCCCC23)cc1F |
| InChI | InChI=1S/C14H20FN3O2S/c15-11-9-10(4-5-12(11)16)21(19,20)17-13-6-8-18-7-2-1-3-14(13)18/h4-5,9,13-14,17H,1-3,6-8,16H2 |
| InChIKey | YMLWDMCCZYETQN-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|