C14H19F2N3 — CID 62533189
2-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-3,4-difluorobenzene-1,2-diamine (PubChem CID 62533189) has the molecular formula C14H19F2N3 and a molecular weight of 267.32 g/mol. Its IUPAC name is 2-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-3,4-difluorobenzene-1,2-diamine.
| Compound Name | 2-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-3,4-difluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 62533189 |
| Molecular Formula | C14H19F2N3 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 2-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-3,4-difluorobenzene-1,2-diamine |
| SMILES | Nc1ccc(F)c(F)c1NC1CCN2CCCCC12 |
| InChI | InChI=1S/C14H19F2N3/c15-9-4-5-10(17)14(13(9)16)18-11-6-8-19-7-2-1-3-12(11)19/h4-5,11-12,18H,1-3,6-8,17H2 |
| InChIKey | OWDAWPIVVVUFAM-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|