C13H15ClF2N2 — CID 83081941
N-(2-chloro-4,6-difluorophenyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-amine (PubChem CID 83081941) has the molecular formula C13H15ClF2N2 and a molecular weight of 272.73 g/mol. Its IUPAC name is N-(2-chloro-4,6-difluorophenyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-amine.
| Compound Name | N-(2-chloro-4,6-difluorophenyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-amine |
|---|---|
| PubChem CID | 83081941 |
| Molecular Formula | C13H15ClF2N2 |
| Molecular Weight | 272.73 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | N-(2-chloro-4,6-difluorophenyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-amine |
| SMILES | Fc1cc(F)c(NC2CCN3CCCC23)c(Cl)c1 |
| InChI | InChI=1S/C13H15ClF2N2/c14-9-6-8(15)7-10(16)13(9)17-11-3-5-18-4-1-2-12(11)18/h6-7,11-12,17H,1-5H2 |
| InChIKey | LDLMNDAAVFAWNT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.73 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |