C13H16F2N2 — CID 82853708
N-(2,4-difluorophenyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-amine (PubChem CID 82853708) has the molecular formula C13H16F2N2 and a molecular weight of 238.28 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-amine.
| Compound Name | N-(2,4-difluorophenyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-amine |
|---|---|
| PubChem CID | 82853708 |
| Molecular Formula | C13H16F2N2 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | N-(2,4-difluorophenyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-amine |
| SMILES | Fc1ccc(NC2CCN3CCCC23)c(F)c1 |
| InChI | InChI=1S/C13H16F2N2/c14-9-3-4-11(10(15)8-9)16-12-5-7-17-6-1-2-13(12)17/h3-4,8,12-13,16H,1-2,5-7H2 |
| InChIKey | VZOWFJGEADTKBQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |