C14H17F2N3S — CID 107934738
2,3-difluoro-4-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)benzenecarbothioamide (PubChem CID 107934738) has the molecular formula C14H17F2N3S and a molecular weight of 297.37 g/mol. Its IUPAC name is 2,3-difluoro-4-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)benzenecarbothioamide.
| Compound Name | 2,3-difluoro-4-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 107934738 |
| Molecular Formula | C14H17F2N3S |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 2,3-difluoro-4-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(NC2CCN3CCCC23)c(F)c1F |
| InChI | InChI=1S/C14H17F2N3S/c15-12-8(14(17)20)3-4-10(13(12)16)18-9-5-7-19-6-1-2-11(9)19/h3-4,9,11,18H,1-2,5-7H2,(H2,17,20) |
| InChIKey | VWMXAHZXAPCTKW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|