C12H14F2N2OS2 — CID 107935258
2,3-difluoro-4-[(1-oxothian-4-yl)amino]benzenecarbothioamide (PubChem CID 107935258) has the molecular formula C12H14F2N2OS2 and a molecular weight of 304.39 g/mol. Its IUPAC name is 2,3-difluoro-4-[(1-oxothian-4-yl)amino]benzenecarbothioamide.
| Compound Name | 2,3-difluoro-4-[(1-oxothian-4-yl)amino]benzenecarbothioamide |
|---|---|
| PubChem CID | 107935258 |
| Molecular Formula | C12H14F2N2OS2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 2,3-difluoro-4-[(1-oxothian-4-yl)amino]benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(NC2CCS(=O)CC2)c(F)c1F |
| InChI | InChI=1S/C12H14F2N2OS2/c13-10-8(12(15)18)1-2-9(11(10)14)16-7-3-5-19(17)6-4-7/h1-2,7,16H,3-6H2,(H2,15,18) |
| InChIKey | UOYZILFJZHSQTQ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|