C15H20BrFN2S — CID 107534819
2-bromo-4-[(4-ethylcyclohexyl)amino]-3-fluorobenzenecarbothioamide (PubChem CID 107534819) has the molecular formula C15H20BrFN2S and a molecular weight of 359.31 g/mol. Its IUPAC name is 2-bromo-4-[(4-ethylcyclohexyl)amino]-3-fluorobenzenecarbothioamide.
| Compound Name | 2-bromo-4-[(4-ethylcyclohexyl)amino]-3-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 107534819 |
| Molecular Formula | C15H20BrFN2S |
| Molecular Weight | 359.31 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | 2-bromo-4-[(4-ethylcyclohexyl)amino]-3-fluorobenzenecarbothioamide |
| SMILES | CCC1CCC(Nc2ccc(C(N)=S)c(Br)c2F)CC1 |
| InChI | InChI=1S/C15H20BrFN2S/c1-2-9-3-5-10(6-4-9)19-12-8-7-11(15(18)20)13(16)14(12)17/h7-10,19H,2-6H2,1H3,(H2,18,20) |
| InChIKey | RWYKELCAMDAWKZ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.31 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|