C12H15F2N3S — CID 107934668
2,3-difluoro-4-[(1-methylpyrrolidin-3-yl)amino]benzenecarbothioamide (PubChem CID 107934668) has the molecular formula C12H15F2N3S and a molecular weight of 271.34 g/mol. Its IUPAC name is 2,3-difluoro-4-[(1-methylpyrrolidin-3-yl)amino]benzenecarbothioamide.
| Compound Name | 2,3-difluoro-4-[(1-methylpyrrolidin-3-yl)amino]benzenecarbothioamide |
|---|---|
| PubChem CID | 107934668 |
| Molecular Formula | C12H15F2N3S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 2,3-difluoro-4-[(1-methylpyrrolidin-3-yl)amino]benzenecarbothioamide |
| SMILES | CN1CCC(Nc2ccc(C(N)=S)c(F)c2F)C1 |
| InChI | InChI=1S/C12H15F2N3S/c1-17-5-4-7(6-17)16-9-3-2-8(12(15)18)10(13)11(9)14/h2-3,7,16H,4-6H2,1H3,(H2,15,18) |
| InChIKey | MESCDYZGFKNDFK-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|