C11H16FN3 — CID 61462092
3-fluoro-1-N-(1-methylpyrrolidin-3-yl)benzene-1,2-diamine (PubChem CID 61462092) has the molecular formula C11H16FN3 and a molecular weight of 209.27 g/mol. Its IUPAC name is 3-fluoro-1-N-(1-methylpyrrolidin-3-yl)benzene-1,2-diamine.
| Compound Name | 3-fluoro-1-N-(1-methylpyrrolidin-3-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 61462092 |
| Molecular Formula | C11H16FN3 |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | 3-fluoro-1-N-(1-methylpyrrolidin-3-yl)benzene-1,2-diamine |
| SMILES | CN1CCC(Nc2cccc(F)c2N)C1 |
| InChI | InChI=1S/C11H16FN3/c1-15-6-5-8(7-15)14-10-4-2-3-9(12)11(10)13/h2-4,8,14H,5-7,13H2,1H3 |
| InChIKey | VNIMMVLPPLWANQ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|