C20H32FN3O — CID 67344064
1-N-[1-(4-ethoxy-1-methylcyclohexyl)piperidin-4-yl]-3-fluorobenzene-1,2-diamine (PubChem CID 67344064) has the molecular formula C20H32FN3O and a molecular weight of 349.49 g/mol. Its IUPAC name is 1-N-[1-(4-ethoxy-1-methylcyclohexyl)piperidin-4-yl]-3-fluorobenzene-1,2-diamine.
| Compound Name | 1-N-[1-(4-ethoxy-1-methylcyclohexyl)piperidin-4-yl]-3-fluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 67344064 |
| Molecular Formula | C20H32FN3O |
| Molecular Weight | 349.49 g/mol |
| Exact Mass | 349.25 |
| IUPAC Name | 1-N-[1-(4-ethoxy-1-methylcyclohexyl)piperidin-4-yl]-3-fluorobenzene-1,2-diamine |
| SMILES | CCOC1CCC(C)(N2CCC(Nc3cccc(F)c3N)CC2)CC1 |
| InChI | InChI=1S/C20H32FN3O/c1-3-25-16-7-11-20(2,12-8-16)24-13-9-15(10-14-24)23-18-6-4-5-17(21)19(18)22/h4-6,15-16,23H,3,7-14,22H2,1-2H3 |
| InChIKey | RIGHLUSHAIGXGN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.49 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|