C19H27F2N3O3 — CID 58409120
N-(3,5-difluoro-2-nitrophenyl)-1-(4-methoxy-1-methylcyclohexyl)piperidin-4-amine (PubChem CID 58409120) has the molecular formula C19H27F2N3O3 and a molecular weight of 383.44 g/mol. Its IUPAC name is N-(3,5-difluoro-2-nitrophenyl)-1-(4-methoxy-1-methylcyclohexyl)piperidin-4-amine.
| Compound Name | N-(3,5-difluoro-2-nitrophenyl)-1-(4-methoxy-1-methylcyclohexyl)piperidin-4-amine |
|---|---|
| PubChem CID | 58409120 |
| Molecular Formula | C19H27F2N3O3 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | N-(3,5-difluoro-2-nitrophenyl)-1-(4-methoxy-1-methylcyclohexyl)piperidin-4-amine |
| SMILES | COC1CCC(C)(N2CCC(Nc3cc(F)cc(F)c3[N+](=O)[O-])CC2)CC1 |
| InChI | InChI=1S/C19H27F2N3O3/c1-19(7-3-15(27-2)4-8-19)23-9-5-14(6-10-23)22-17-12-13(20)11-16(21)18(17)24(25)26/h11-12,14-15,22H,3-10H2,1-2H3 |
| InChIKey | VMVCSRJKXLNWAH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|