C11H12F2N2OS — CID 114017848
2,3-difluoro-4-(oxolan-3-ylamino)benzenecarbothioamide (PubChem CID 114017848) has the molecular formula C11H12F2N2OS and a molecular weight of 258.29 g/mol. Its IUPAC name is 2,3-difluoro-4-(oxolan-3-ylamino)benzenecarbothioamide.
| Compound Name | 2,3-difluoro-4-(oxolan-3-ylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 114017848 |
| Molecular Formula | C11H12F2N2OS |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 2,3-difluoro-4-(oxolan-3-ylamino)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(NC2CCOC2)c(F)c1F |
| InChI | InChI=1S/C11H12F2N2OS/c12-9-7(11(14)17)1-2-8(10(9)13)15-6-3-4-16-5-6/h1-2,6,15H,3-5H2,(H2,14,17) |
| InChIKey | DPXCQMJEANIALT-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|