C12H15FN2OS — CID 43657973
3-fluoro-4-(oxan-4-ylamino)benzenecarbothioamide (PubChem CID 43657973) has the molecular formula C12H15FN2OS and a molecular weight of 254.33 g/mol. Its IUPAC name is 3-fluoro-4-(oxan-4-ylamino)benzenecarbothioamide.
| Compound Name | 3-fluoro-4-(oxan-4-ylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 43657973 |
| Molecular Formula | C12H15FN2OS |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 3-fluoro-4-(oxan-4-ylamino)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(NC2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C12H15FN2OS/c13-10-7-8(12(14)17)1-2-11(10)15-9-3-5-16-6-4-9/h1-2,7,9,15H,3-6H2,(H2,14,17) |
| InChIKey | JBZDALFMDZLGEN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|