C11H13FN2OS — CID 80712561
3-fluoro-4-(oxolan-3-ylamino)benzenecarbothioamide (PubChem CID 80712561) has the molecular formula C11H13FN2OS and a molecular weight of 240.30 g/mol. Its IUPAC name is 3-fluoro-4-(oxolan-3-ylamino)benzenecarbothioamide.
| Compound Name | 3-fluoro-4-(oxolan-3-ylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 80712561 |
| Molecular Formula | C11H13FN2OS |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 3-fluoro-4-(oxolan-3-ylamino)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(NC2CCOC2)c(F)c1 |
| InChI | InChI=1S/C11H13FN2OS/c12-9-5-7(11(13)16)1-2-10(9)14-8-3-4-15-6-8/h1-2,5,8,14H,3-4,6H2,(H2,13,16) |
| InChIKey | ZHFMWOAPFZHPIC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|