C10H13FN2O — CID 80716587
2-fluoro-1-N-(oxolan-3-yl)benzene-1,4-diamine (PubChem CID 80716587) has the molecular formula C10H13FN2O and a molecular weight of 196.23 g/mol. Its IUPAC name is 2-fluoro-1-N-(oxolan-3-yl)benzene-1,4-diamine.
| Compound Name | 2-fluoro-1-N-(oxolan-3-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 80716587 |
| Molecular Formula | C10H13FN2O |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 2-fluoro-1-N-(oxolan-3-yl)benzene-1,4-diamine |
| SMILES | Nc1ccc(NC2CCOC2)c(F)c1 |
| InChI | InChI=1S/C10H13FN2O/c11-9-5-7(12)1-2-10(9)13-8-3-4-14-6-8/h1-2,5,8,13H,3-4,6,12H2 |
| InChIKey | ZUBQCCGCQJQRIO-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|