C13H18ClN3S — CID 55154328
2-chloro-4-[(1-methylpiperidin-3-yl)amino]benzenecarbothioamide (PubChem CID 55154328) has the molecular formula C13H18ClN3S and a molecular weight of 283.83 g/mol. Its IUPAC name is 2-chloro-4-[(1-methylpiperidin-3-yl)amino]benzenecarbothioamide.
| Compound Name | 2-chloro-4-[(1-methylpiperidin-3-yl)amino]benzenecarbothioamide |
|---|---|
| PubChem CID | 55154328 |
| Molecular Formula | C13H18ClN3S |
| Molecular Weight | 283.83 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 2-chloro-4-[(1-methylpiperidin-3-yl)amino]benzenecarbothioamide |
| SMILES | CN1CCCC(Nc2ccc(C(N)=S)c(Cl)c2)C1 |
| InChI | InChI=1S/C13H18ClN3S/c1-17-6-2-3-10(8-17)16-9-4-5-11(13(15)18)12(14)7-9/h4-5,7,10,16H,2-3,6,8H2,1H3,(H2,15,18) |
| InChIKey | USLZYTFFSLYQDH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.83 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|