C20H25N3S — CID 113259599
4-[(1-benzylpiperidin-3-yl)amino]-2-methylbenzenecarbothioamide (PubChem CID 113259599) has the molecular formula C20H25N3S and a molecular weight of 339.51 g/mol. Its IUPAC name is 4-[(1-benzylpiperidin-3-yl)amino]-2-methylbenzenecarbothioamide.
| Compound Name | 4-[(1-benzylpiperidin-3-yl)amino]-2-methylbenzenecarbothioamide |
|---|---|
| PubChem CID | 113259599 |
| Molecular Formula | C20H25N3S |
| Molecular Weight | 339.51 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 4-[(1-benzylpiperidin-3-yl)amino]-2-methylbenzenecarbothioamide |
| SMILES | Cc1cc(NC2CCCN(Cc3ccccc3)C2)ccc1C(N)=S |
| InChI | InChI=1S/C20H25N3S/c1-15-12-17(9-10-19(15)20(21)24)22-18-8-5-11-23(14-18)13-16-6-3-2-4-7-16/h2-4,6-7,9-10,12,18,22H,5,8,11,13-14H2,1H3,(H2,21,24) |
| InChIKey | LPSFKAPBWGUJIQ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.51 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|