C21H23N3O — CID 59290566
6-[[(3R)-1-benzylpiperidin-3-yl]amino]-2H-isoquinolin-1-one (PubChem CID 59290566) has the molecular formula C21H23N3O and a molecular weight of 333.44 g/mol. Its IUPAC name is 6-[[(3R)-1-benzylpiperidin-3-yl]amino]-2H-isoquinolin-1-one.
| Compound Name | 6-[[(3R)-1-benzylpiperidin-3-yl]amino]-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 59290566 |
| Molecular Formula | C21H23N3O |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | 6-[[(3R)-1-benzylpiperidin-3-yl]amino]-2H-isoquinolin-1-one |
| SMILES | O=c1[nH]ccc2cc(N[C@@H]3CCCN(Cc4ccccc4)C3)ccc12 |
| InChI | InChI=1S/C21H23N3O/c25-21-20-9-8-18(13-17(20)10-11-22-21)23-19-7-4-12-24(15-19)14-16-5-2-1-3-6-16/h1-3,5-6,8-11,13,19,23H,4,7,12,14-15H2,(H,22,25)/t19-/m1/s1 |
| InChIKey | GAUVWDCIOADOMU-LJQANCHMSA-N |
| XLogP | 3.60 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |