C20H21N3O — CID 59290709
6-[[(3R)-1-benzylpyrrolidin-3-yl]amino]-2H-isoquinolin-1-one (PubChem CID 59290709) has the molecular formula C20H21N3O and a molecular weight of 319.41 g/mol. Its IUPAC name is 6-[[(3R)-1-benzylpyrrolidin-3-yl]amino]-2H-isoquinolin-1-one.
| Compound Name | 6-[[(3R)-1-benzylpyrrolidin-3-yl]amino]-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 59290709 |
| Molecular Formula | C20H21N3O |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 6-[[(3R)-1-benzylpyrrolidin-3-yl]amino]-2H-isoquinolin-1-one |
| SMILES | O=c1[nH]ccc2cc(N[C@@H]3CCN(Cc4ccccc4)C3)ccc12 |
| InChI | InChI=1S/C20H21N3O/c24-20-19-7-6-17(12-16(19)8-10-21-20)22-18-9-11-23(14-18)13-15-4-2-1-3-5-15/h1-8,10,12,18,22H,9,11,13-14H2,(H,21,24)/t18-/m1/s1 |
| InChIKey | RGYMTQXWLQOOLF-GOSISDBHSA-N |
| XLogP | 3.21 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |