C18H20N4 — CID 95719332
N-[(3S)-1-benzylpyrrolidin-3-yl]-1H-pyrrolo[2,3-b]pyridin-6-amine (PubChem CID 95719332) has the molecular formula C18H20N4 and a molecular weight of 292.39 g/mol. Its IUPAC name is N-[(3S)-1-benzylpyrrolidin-3-yl]-1H-pyrrolo[2,3-b]pyridin-6-amine.
| Compound Name | N-[(3S)-1-benzylpyrrolidin-3-yl]-1H-pyrrolo[2,3-b]pyridin-6-amine |
|---|---|
| PubChem CID | 95719332 |
| Molecular Formula | C18H20N4 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | N-[(3S)-1-benzylpyrrolidin-3-yl]-1H-pyrrolo[2,3-b]pyridin-6-amine |
| SMILES | c1ccc(CN2CC[C@H](Nc3ccc4cc[nH]c4n3)C2)cc1 |
| InChI | InChI=1S/C18H20N4/c1-2-4-14(5-3-1)12-22-11-9-16(13-22)20-17-7-6-15-8-10-19-18(15)21-17/h1-8,10,16H,9,11-13H2,(H2,19,20,21)/t16-/m0/s1 |
| InChIKey | CECSEVYSFIBBIE-INIZCTEOSA-N |
| XLogP | 3.25 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |