C14H17ClN6 — CID 130559113
2-N-(1-benzylpyrrolidin-3-yl)-6-chloro-1,3,5-triazine-2,4-diamine (PubChem CID 130559113) has the molecular formula C14H17ClN6 and a molecular weight of 304.79 g/mol. Its IUPAC name is 2-N-(1-benzylpyrrolidin-3-yl)-6-chloro-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(1-benzylpyrrolidin-3-yl)-6-chloro-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 130559113 |
| Molecular Formula | C14H17ClN6 |
| Molecular Weight | 304.79 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 2-N-(1-benzylpyrrolidin-3-yl)-6-chloro-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(Cl)nc(NC2CCN(Cc3ccccc3)C2)n1 |
| InChI | InChI=1S/C14H17ClN6/c15-12-18-13(16)20-14(19-12)17-11-6-7-21(9-11)8-10-4-2-1-3-5-10/h1-5,11H,6-9H2,(H3,16,17,18,19,20) |
| InChIKey | NJQMRPVEJURZTK-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.79 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |