C21H29N5 — CID 66903517
4-(azepan-1-yl)-N-[(3R)-1-benzylpyrrolidin-3-yl]pyrimidin-2-amine (PubChem CID 66903517) has the molecular formula C21H29N5 and a molecular weight of 351.50 g/mol. Its IUPAC name is 4-(azepan-1-yl)-N-[(3R)-1-benzylpyrrolidin-3-yl]pyrimidin-2-amine.
| Compound Name | 4-(azepan-1-yl)-N-[(3R)-1-benzylpyrrolidin-3-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 66903517 |
| Molecular Formula | C21H29N5 |
| Molecular Weight | 351.50 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | 4-(azepan-1-yl)-N-[(3R)-1-benzylpyrrolidin-3-yl]pyrimidin-2-amine |
| SMILES | c1ccc(CN2CC[C@@H](Nc3nccc(N4CCCCCC4)n3)C2)cc1 |
| InChI | InChI=1S/C21H29N5/c1-2-7-14-26(13-6-1)20-10-12-22-21(24-20)23-19-11-15-25(17-19)16-18-8-4-3-5-9-18/h3-5,8-10,12,19H,1-2,6-7,11,13-17H2,(H,22,23,24)/t19-/m1/s1 |
| InChIKey | ITQKQTAFSZRQTM-LJQANCHMSA-N |
| XLogP | 3.54 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.50 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |