C20H29N5S — CID 66903863
4-(azepan-1-yl)-N-[1-(thiophen-2-ylmethyl)piperidin-3-yl]pyrimidin-2-amine (PubChem CID 66903863) has the molecular formula C20H29N5S and a molecular weight of 371.55 g/mol. Its IUPAC name is 4-(azepan-1-yl)-N-[1-(thiophen-2-ylmethyl)piperidin-3-yl]pyrimidin-2-amine.
| Compound Name | 4-(azepan-1-yl)-N-[1-(thiophen-2-ylmethyl)piperidin-3-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 66903863 |
| Molecular Formula | C20H29N5S |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | 4-(azepan-1-yl)-N-[1-(thiophen-2-ylmethyl)piperidin-3-yl]pyrimidin-2-amine |
| SMILES | c1csc(CN2CCCC(Nc3nccc(N4CCCCCC4)n3)C2)c1 |
| InChI | InChI=1S/C20H29N5S/c1-2-4-13-25(12-3-1)19-9-10-21-20(23-19)22-17-7-5-11-24(15-17)16-18-8-6-14-26-18/h6,8-10,14,17H,1-5,7,11-13,15-16H2,(H,21,22,23) |
| InChIKey | OTHKHNVXRCFTQC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |