C16H27N3O2S2 — CID 131895476
N-[1-(thiophen-2-ylmethyl)piperidin-3-yl]azepane-1-sulfonamide (PubChem CID 131895476) has the molecular formula C16H27N3O2S2 and a molecular weight of 357.55 g/mol. Its IUPAC name is N-[1-(thiophen-2-ylmethyl)piperidin-3-yl]azepane-1-sulfonamide.
| Compound Name | N-[1-(thiophen-2-ylmethyl)piperidin-3-yl]azepane-1-sulfonamide |
|---|---|
| PubChem CID | 131895476 |
| Molecular Formula | C16H27N3O2S2 |
| Molecular Weight | 357.55 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | N-[1-(thiophen-2-ylmethyl)piperidin-3-yl]azepane-1-sulfonamide |
| SMILES | O=S(=O)(NC1CCCN(Cc2cccs2)C1)N1CCCCCC1 |
| InChI | InChI=1S/C16H27N3O2S2/c20-23(21,19-10-3-1-2-4-11-19)17-15-7-5-9-18(13-15)14-16-8-6-12-22-16/h6,8,12,15,17H,1-5,7,9-11,13-14H2 |
| InChIKey | SKLDFBOFHOHVJS-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.55 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |